mirror of https://github.com/zcash/simtfl.git
Compare commits
3 Commits
14877fd959
...
19c30cf11a
Author | SHA1 | Date |
---|---|---|
Daira Emma Hopwood | 19c30cf11a | |
Daira Emma Hopwood | 6bdd41f1c8 | |
Daira Emma Hopwood | 1af789f04e |
|
@ -14,301 +14,3 @@ collects the fees paid by the other transactions in the block.
|
|||
The simulation of the shielded protocol does not attempt to model any
|
||||
actual privacy properties.
|
||||
"""
|
||||
|
||||
|
||||
from __future__ import annotations
|
||||
from typing import Iterable, Optional
|
||||
from collections.abc import Sequence
|
||||
from dataclasses import dataclass
|
||||
from enum import Enum, auto
|
||||
|
||||
from collections import deque
|
||||
from itertools import chain, islice
|
||||
from sys import version_info
|
||||
|
||||
from ..util import Unique
|
||||
|
||||
|
||||
class BlockHash(Unique):
|
||||
"""Unique value representing a best-chain block hash."""
|
||||
pass
|
||||
|
||||
|
||||
class BCTransaction:
|
||||
"""A transaction for a best-chain protocol."""
|
||||
|
||||
@dataclass(frozen=True)
|
||||
class _TXO:
|
||||
tx: BCTransaction
|
||||
index: int
|
||||
value: int
|
||||
|
||||
@dataclass(eq=False)
|
||||
class _Note(Unique):
|
||||
"""
|
||||
A shielded note. Unlike in the actual protocol, we conflate notes, note
|
||||
commitments, and nullifiers. This will be sufficient because we don't
|
||||
need to maintain any actual privacy.
|
||||
|
||||
This is not a frozen dataclass; its identity is important, and models the
|
||||
fact that each note has a unique commitment and nullifier in the actual
|
||||
protocol.
|
||||
"""
|
||||
value: int
|
||||
|
||||
def __init__(self,
|
||||
transparent_inputs: Sequence[BCTransaction._TXO],
|
||||
transparent_output_values: Sequence[int],
|
||||
shielded_inputs: Sequence[BCTransaction._Note],
|
||||
shielded_output_values: Sequence[int],
|
||||
fee: int,
|
||||
anchor: Optional[BCContext]=None,
|
||||
issuance: int=0):
|
||||
"""
|
||||
Constructs a `BCTransaction` with the given transparent inputs, transparent
|
||||
output values, anchor, shielded inputs, shielded output values, fee, and
|
||||
(if it is a coinbase transaction) issuance.
|
||||
|
||||
The elements of `transparent_inputs` are TXO objects obtained from the
|
||||
`transparent_output` method of another `BCTransaction`. The elements of
|
||||
`shielded_inputs` are Note objects obtained from the `shielded_output`
|
||||
method of another `BCTransaction`. The TXO and Note classes are private,
|
||||
and these objects should not be constructed directly.
|
||||
|
||||
The anchor is modelled as a `BCContext` such that
|
||||
`anchor.can_spend(shielded_inputs)`. If there are no shielded inputs,
|
||||
`anchor` must be `None`. The anchor object must not be modified after
|
||||
passing it to this constructor (copy it if necessary).
|
||||
|
||||
For a coinbase transaction, pass `[]` for `transparent_inputs` and
|
||||
`shielded_inputs`, and pass `fee` as a negative value of magnitude equal
|
||||
to the total amount of fees paid by other transactions in the block.
|
||||
"""
|
||||
assert issuance >= 0
|
||||
coinbase = len(transparent_inputs) + len(shielded_inputs) == 0
|
||||
assert fee >= 0 or coinbase
|
||||
assert issuance == 0 or coinbase
|
||||
assert all((v >= 0 for v in chain(transparent_output_values, shielded_output_values)))
|
||||
assert (
|
||||
sum((txin.value for txin in transparent_inputs))
|
||||
+ sum((note.value for note in shielded_inputs))
|
||||
+ issuance ==
|
||||
sum(transparent_output_values)
|
||||
+ sum(shielded_output_values)
|
||||
+ fee
|
||||
)
|
||||
assert anchor is None if len(shielded_inputs) == 0 else (
|
||||
anchor is not None and anchor.can_spend(shielded_inputs))
|
||||
|
||||
self.transparent_inputs = transparent_inputs
|
||||
self.transparent_outputs = [self._TXO(self, i, v)
|
||||
for (i, v) in enumerate(transparent_output_values)]
|
||||
self.shielded_inputs = shielded_inputs
|
||||
self.shielded_outputs = [self._Note(v) for v in shielded_output_values]
|
||||
self.fee = fee
|
||||
self.anchor = anchor
|
||||
self.issuance = issuance
|
||||
|
||||
def transparent_input(self, index: int) -> BCTransaction._TXO:
|
||||
"""Returns the transparent input TXO with the given index."""
|
||||
return self.transparent_inputs[index]
|
||||
|
||||
def transparent_output(self, index: int) -> BCTransaction._TXO:
|
||||
"""Returns the transparent output TXO with the given index."""
|
||||
return self.transparent_outputs[index]
|
||||
|
||||
def shielded_input(self, index: int) -> BCTransaction._Note:
|
||||
"""Returns the shielded input note with the given index."""
|
||||
return self.shielded_inputs[index]
|
||||
|
||||
def shielded_output(self, index: int) -> BCTransaction._Note:
|
||||
"""Returns the shielded output note with the given index."""
|
||||
return self.shielded_outputs[index]
|
||||
|
||||
def is_coinbase(self) -> bool:
|
||||
"""
|
||||
Returns `True` if this is a coinbase transaction (it has no inputs).
|
||||
"""
|
||||
return len(self.transparent_inputs) + len(self.shielded_inputs) == 0
|
||||
|
||||
|
||||
class Spentness(Enum):
|
||||
"""The spentness status of a note."""
|
||||
Unspent = auto()
|
||||
"""The note is unspent."""
|
||||
Spent = auto()
|
||||
"""The note is spent."""
|
||||
|
||||
|
||||
class BCContext:
|
||||
"""
|
||||
A context that allows checking transactions for contextual validity in a
|
||||
best-chain protocol.
|
||||
"""
|
||||
|
||||
assert version_info >= (3, 7), "This code relies on insertion-ordered dicts."
|
||||
|
||||
def __init__(self):
|
||||
"""Constructs an empty `BCContext`."""
|
||||
self.transactions: deque[BCTransaction] = deque()
|
||||
self.utxo_set: set[BCTransaction._TXO] = set()
|
||||
|
||||
# Since dicts are insertion-ordered, this models the sequence in which
|
||||
# notes are committed as well as their spentness.
|
||||
self.notes: dict[BCTransaction._Note, Spentness] = {}
|
||||
|
||||
self.total_issuance = 0
|
||||
|
||||
def committed_notes(self) -> list[(BCTransaction._Note, Spentness)]:
|
||||
"""
|
||||
Returns a list of (`Note`, `Spentness`) for notes added to this context,
|
||||
preserving the commitment order.
|
||||
"""
|
||||
return list(self.notes.items())
|
||||
|
||||
def can_spend(self, tospend: Iterable[BCTransaction._Note]) -> bool:
|
||||
"""Can all of the notes in `tospend` be spent in this context?"""
|
||||
return all((self.notes.get(note) == Spentness.Unspent for note in tospend))
|
||||
|
||||
def _check(self, tx: BCTransaction) -> tuple[bool, set[BCTransaction._TXO]]:
|
||||
"""
|
||||
Checks whether `tx` is valid. To avoid recomputation, this returns
|
||||
a pair of the validity, and the set of transparent inputs of `tx`.
|
||||
"""
|
||||
txins = set(tx.transparent_inputs)
|
||||
valid = txins.issubset(self.utxo_set) and self.can_spend(tx.shielded_inputs)
|
||||
return (valid, txins)
|
||||
|
||||
def is_valid(self, tx: BCTransaction) -> bool:
|
||||
"""Is `tx` valid in this context?"""
|
||||
return self._check(tx)[0]
|
||||
|
||||
def add_if_valid(self, tx: BCTransaction) -> bool:
|
||||
"""
|
||||
If `tx` is valid in this context, add it to the context and return `True`.
|
||||
Otherwise leave the context unchanged and return `False`.
|
||||
"""
|
||||
(valid, txins) = self._check(tx)
|
||||
if valid:
|
||||
self.utxo_set -= txins
|
||||
self.utxo_set |= set(tx.transparent_outputs)
|
||||
|
||||
for note in tx.shielded_inputs:
|
||||
self.notes[note] = Spentness.Spent
|
||||
for note in tx.shielded_outputs:
|
||||
assert note not in self.notes
|
||||
self.notes[note] = Spentness.Unspent
|
||||
|
||||
self.total_issuance += tx.issuance
|
||||
self.transactions.append(tx)
|
||||
|
||||
return valid
|
||||
|
||||
def copy(self) -> BCContext:
|
||||
"""Returns an independent copy of this `BCContext`."""
|
||||
ctx = BCContext()
|
||||
ctx.transactions = self.transactions.copy()
|
||||
ctx.utxo_set = self.utxo_set.copy()
|
||||
ctx.notes = self.notes.copy()
|
||||
ctx.total_issuance = self.total_issuance
|
||||
return ctx
|
||||
|
||||
|
||||
class BCBlock:
|
||||
"""A block in a best-chain protocol."""
|
||||
|
||||
def __init__(self,
|
||||
parent: Optional[BCBlock],
|
||||
added_score: int,
|
||||
transactions: Sequence[BCTransaction],
|
||||
allow_invalid: bool=False):
|
||||
"""
|
||||
Constructs a `BCBlock` with the given parent block, score relative to the
|
||||
parent, and sequence of transactions. `transactions` must not be modified
|
||||
after passing it to this constructor (copy it if necessary).
|
||||
If `allow_invalid` is set, the block need not be valid.
|
||||
Use `parent=None` to construct the genesis block.
|
||||
"""
|
||||
self.parent = parent
|
||||
self.score = added_score
|
||||
if self.parent is not None:
|
||||
self.score += self.parent.score
|
||||
self.transactions = transactions
|
||||
self.hash = BlockHash()
|
||||
if not allow_invalid:
|
||||
self.assert_noncontextually_valid()
|
||||
|
||||
def assert_noncontextually_valid(self) -> None:
|
||||
"""Assert that non-contextual consensus rules are satisfied for this block."""
|
||||
assert len(self.transactions) > 0
|
||||
assert self.transactions[0].is_coinbase()
|
||||
assert not any((tx.is_coinbase() for tx in islice(self.transactions, 1, None)))
|
||||
assert sum((tx.fee for tx in self.transactions)) == 0
|
||||
|
||||
def is_noncontextually_valid(self) -> bool:
|
||||
"""Are non-contextual consensus rules satisfied for this block?"""
|
||||
try:
|
||||
self.assert_noncontextually_valid()
|
||||
return True
|
||||
except AssertionError:
|
||||
return False
|
||||
|
||||
|
||||
@dataclass
|
||||
class BCProtocol:
|
||||
"""A best-chain protocol."""
|
||||
|
||||
Transaction: type[object] = BCTransaction
|
||||
"""The type of transactions for this protocol."""
|
||||
|
||||
Context: type[object] = BCContext
|
||||
"""The type of contexts for this protocol."""
|
||||
|
||||
Block: type[object] = BCBlock
|
||||
"""The type of blocks for this protocol."""
|
||||
|
||||
|
||||
__all__ = ['BCTransaction', 'BCContext', 'BCBlock', 'BCProtocol', 'BlockHash', 'Spentness']
|
||||
|
||||
|
||||
import unittest
|
||||
|
||||
|
||||
class TestBC(unittest.TestCase):
|
||||
def test_basic(self) -> None:
|
||||
ctx = BCContext()
|
||||
coinbase_tx0 = BCTransaction([], [10], [], [], 0, issuance=10)
|
||||
self.assertTrue(ctx.add_if_valid(coinbase_tx0))
|
||||
genesis = BCBlock(None, 1, [coinbase_tx0])
|
||||
self.assertEqual(genesis.score, 1)
|
||||
self.assertEqual(ctx.total_issuance, 10)
|
||||
|
||||
coinbase_tx1 = BCTransaction([], [6], [], [], -1, issuance=5)
|
||||
spend_tx = BCTransaction([coinbase_tx0.transparent_output(0)], [9], [], [], 1)
|
||||
self.assertTrue(ctx.add_if_valid(coinbase_tx1))
|
||||
self.assertTrue(ctx.add_if_valid(spend_tx))
|
||||
block1 = BCBlock(genesis, 1, [coinbase_tx1, spend_tx])
|
||||
self.assertEqual(block1.score, 2)
|
||||
self.assertEqual(ctx.total_issuance, 15)
|
||||
|
||||
coinbase_tx2 = BCTransaction([], [6], [], [], -1, issuance=5)
|
||||
shielding_tx = BCTransaction([coinbase_tx1.transparent_output(0), spend_tx.transparent_output(0)],
|
||||
[], [], [8, 6], 1)
|
||||
self.assertTrue(ctx.add_if_valid(coinbase_tx2))
|
||||
self.assertTrue(ctx.add_if_valid(shielding_tx))
|
||||
block2 = BCBlock(block1, 2, [coinbase_tx2, shielding_tx])
|
||||
block2_anchor = ctx.copy()
|
||||
self.assertEqual(block2.score, 4)
|
||||
self.assertEqual(ctx.total_issuance, 20)
|
||||
|
||||
coinbase_tx3 = BCTransaction([], [7], [], [], -2, issuance=5)
|
||||
shielded_tx = BCTransaction([], [], [shielding_tx.shielded_output(0)], [7], 1,
|
||||
anchor=block2_anchor)
|
||||
deshielding_tx = BCTransaction([], [5], [shielding_tx.shielded_output(1)], [], 1,
|
||||
anchor=block2_anchor)
|
||||
self.assertTrue(ctx.add_if_valid(coinbase_tx3))
|
||||
self.assertTrue(ctx.add_if_valid(shielded_tx))
|
||||
self.assertTrue(ctx.add_if_valid(deshielding_tx))
|
||||
block3 = BCBlock(block2, 3, [coinbase_tx3, shielded_tx, deshielding_tx])
|
||||
self.assertEqual(block3.score, 7)
|
||||
self.assertEqual(ctx.total_issuance, 25)
|
||||
|
|
|
@ -0,0 +1,301 @@
|
|||
"""
|
||||
Abstractions for best-chain transactions, contexts, and blocks.
|
||||
"""
|
||||
|
||||
|
||||
from __future__ import annotations
|
||||
from typing import Iterable, Optional, TypeAlias
|
||||
from collections.abc import Sequence
|
||||
from dataclasses import dataclass
|
||||
from enum import Enum, auto
|
||||
|
||||
from collections import deque
|
||||
from itertools import chain, islice
|
||||
from sys import version_info
|
||||
|
||||
from ..util import Unique
|
||||
|
||||
|
||||
class BlockHash(Unique):
|
||||
"""Unique value representing a best-chain block hash."""
|
||||
pass
|
||||
|
||||
|
||||
class BCTransaction:
|
||||
"""A transaction for a best-chain protocol."""
|
||||
|
||||
@dataclass(frozen=True)
|
||||
class _TXO:
|
||||
tx: BCTransaction
|
||||
index: int
|
||||
value: int
|
||||
|
||||
@dataclass(eq=False)
|
||||
class _Note(Unique):
|
||||
"""
|
||||
A shielded note. Unlike in the actual protocol, we conflate notes, note
|
||||
commitments, and nullifiers. This will be sufficient because we don't
|
||||
need to maintain any actual privacy.
|
||||
|
||||
This is not a frozen dataclass; its identity is important, and models the
|
||||
fact that each note has a unique commitment and nullifier in the actual
|
||||
protocol.
|
||||
"""
|
||||
value: int
|
||||
|
||||
def __init__(self,
|
||||
transparent_inputs: Sequence[BCTransaction._TXO],
|
||||
transparent_output_values: Sequence[int],
|
||||
shielded_inputs: Sequence[BCTransaction._Note],
|
||||
shielded_output_values: Sequence[int],
|
||||
fee: int,
|
||||
anchor: Optional[BCContext]=None,
|
||||
issuance: int=0):
|
||||
"""
|
||||
Constructs a `BCTransaction` with the given transparent inputs, transparent
|
||||
output values, anchor, shielded inputs, shielded output values, fee, and
|
||||
(if it is a coinbase transaction) issuance.
|
||||
|
||||
The elements of `transparent_inputs` are TXO objects obtained from the
|
||||
`transparent_output` method of another `BCTransaction`. The elements of
|
||||
`shielded_inputs` are Note objects obtained from the `shielded_output`
|
||||
method of another `BCTransaction`. The TXO and Note classes are private,
|
||||
and these objects should not be constructed directly.
|
||||
|
||||
The anchor is modelled as a `BCContext` such that
|
||||
`anchor.can_spend(shielded_inputs)`. If there are no shielded inputs,
|
||||
`anchor` must be `None`. The anchor object must not be modified after
|
||||
passing it to this constructor (copy it if necessary).
|
||||
|
||||
For a coinbase transaction, pass `[]` for `transparent_inputs` and
|
||||
`shielded_inputs`, and pass `fee` as a negative value of magnitude equal
|
||||
to the total amount of fees paid by other transactions in the block.
|
||||
"""
|
||||
assert issuance >= 0
|
||||
coinbase = len(transparent_inputs) + len(shielded_inputs) == 0
|
||||
assert fee >= 0 or coinbase
|
||||
assert issuance == 0 or coinbase
|
||||
assert all((v >= 0 for v in chain(transparent_output_values, shielded_output_values)))
|
||||
assert (
|
||||
sum((txin.value for txin in transparent_inputs))
|
||||
+ sum((note.value for note in shielded_inputs))
|
||||
+ issuance ==
|
||||
sum(transparent_output_values)
|
||||
+ sum(shielded_output_values)
|
||||
+ fee
|
||||
)
|
||||
assert anchor is None if len(shielded_inputs) == 0 else (
|
||||
anchor is not None and anchor.can_spend(shielded_inputs))
|
||||
|
||||
self.transparent_inputs = transparent_inputs
|
||||
self.transparent_outputs = [self._TXO(self, i, v)
|
||||
for (i, v) in enumerate(transparent_output_values)]
|
||||
self.shielded_inputs = shielded_inputs
|
||||
self.shielded_outputs = [self._Note(v) for v in shielded_output_values]
|
||||
self.fee = fee
|
||||
self.anchor = anchor
|
||||
self.issuance = issuance
|
||||
|
||||
def transparent_input(self, index: int) -> BCTransaction._TXO:
|
||||
"""Returns the transparent input TXO with the given index."""
|
||||
return self.transparent_inputs[index]
|
||||
|
||||
def transparent_output(self, index: int) -> BCTransaction._TXO:
|
||||
"""Returns the transparent output TXO with the given index."""
|
||||
return self.transparent_outputs[index]
|
||||
|
||||
def shielded_input(self, index: int) -> BCTransaction._Note:
|
||||
"""Returns the shielded input note with the given index."""
|
||||
return self.shielded_inputs[index]
|
||||
|
||||
def shielded_output(self, index: int) -> BCTransaction._Note:
|
||||
"""Returns the shielded output note with the given index."""
|
||||
return self.shielded_outputs[index]
|
||||
|
||||
def is_coinbase(self) -> bool:
|
||||
"""
|
||||
Returns `True` if this is a coinbase transaction (it has no inputs).
|
||||
"""
|
||||
return len(self.transparent_inputs) + len(self.shielded_inputs) == 0
|
||||
|
||||
|
||||
class Spentness(Enum):
|
||||
"""The spentness status of a note."""
|
||||
Unspent = auto()
|
||||
"""The note is unspent."""
|
||||
Spent = auto()
|
||||
"""The note is spent."""
|
||||
|
||||
|
||||
class BCContext:
|
||||
"""
|
||||
A context that allows checking transactions for contextual validity in a
|
||||
best-chain protocol.
|
||||
"""
|
||||
|
||||
assert version_info >= (3, 7), "This code relies on insertion-ordered dicts."
|
||||
|
||||
def __init__(self):
|
||||
"""Constructs an empty `BCContext`."""
|
||||
self.transactions: deque[BCTransaction] = deque()
|
||||
self.utxo_set: set[BCTransaction._TXO] = set()
|
||||
|
||||
# Since dicts are insertion-ordered, this models the sequence in which
|
||||
# notes are committed as well as their spentness.
|
||||
self.notes: dict[BCTransaction._Note, Spentness] = {}
|
||||
|
||||
self.total_issuance = 0
|
||||
|
||||
def committed_notes(self) -> list[(BCTransaction._Note, Spentness)]:
|
||||
"""
|
||||
Returns a list of (`Note`, `Spentness`) for notes added to this context,
|
||||
preserving the commitment order.
|
||||
"""
|
||||
return list(self.notes.items())
|
||||
|
||||
def can_spend(self, tospend: Iterable[BCTransaction._Note]) -> bool:
|
||||
"""Can all of the notes in `tospend` be spent in this context?"""
|
||||
return all((self.notes.get(note) == Spentness.Unspent for note in tospend))
|
||||
|
||||
def _check(self, tx: BCTransaction) -> tuple[bool, set[BCTransaction._TXO]]:
|
||||
"""
|
||||
Checks whether `tx` is valid. To avoid recomputation, this returns
|
||||
a pair of the validity, and the set of transparent inputs of `tx`.
|
||||
"""
|
||||
txins = set(tx.transparent_inputs)
|
||||
valid = txins.issubset(self.utxo_set) and self.can_spend(tx.shielded_inputs)
|
||||
return (valid, txins)
|
||||
|
||||
def is_valid(self, tx: BCTransaction) -> bool:
|
||||
"""Is `tx` valid in this context?"""
|
||||
return self._check(tx)[0]
|
||||
|
||||
def add_if_valid(self, tx: BCTransaction) -> bool:
|
||||
"""
|
||||
If `tx` is valid in this context, add it to the context and return `True`.
|
||||
Otherwise leave the context unchanged and return `False`.
|
||||
"""
|
||||
(valid, txins) = self._check(tx)
|
||||
if valid:
|
||||
self.utxo_set -= txins
|
||||
self.utxo_set |= set(tx.transparent_outputs)
|
||||
|
||||
for note in tx.shielded_inputs:
|
||||
self.notes[note] = Spentness.Spent
|
||||
for note in tx.shielded_outputs:
|
||||
assert note not in self.notes
|
||||
self.notes[note] = Spentness.Unspent
|
||||
|
||||
self.total_issuance += tx.issuance
|
||||
self.transactions.append(tx)
|
||||
|
||||
return valid
|
||||
|
||||
def copy(self) -> BCContext:
|
||||
"""Returns an independent copy of this `BCContext`."""
|
||||
ctx = BCContext()
|
||||
ctx.transactions = self.transactions.copy()
|
||||
ctx.utxo_set = self.utxo_set.copy()
|
||||
ctx.notes = self.notes.copy()
|
||||
ctx.total_issuance = self.total_issuance
|
||||
return ctx
|
||||
|
||||
|
||||
class BCBlock:
|
||||
"""A block in a best-chain protocol."""
|
||||
|
||||
def __init__(self,
|
||||
parent: Optional[BCBlock],
|
||||
added_score: int,
|
||||
transactions: Sequence[BCTransaction],
|
||||
allow_invalid: bool=False):
|
||||
"""
|
||||
Constructs a `BCBlock` with the given parent block, score relative to the
|
||||
parent, and sequence of transactions. `transactions` must not be modified
|
||||
after passing it to this constructor (copy it if necessary).
|
||||
If `allow_invalid` is set, the block need not be valid.
|
||||
Use `parent=None` to construct the genesis block.
|
||||
"""
|
||||
self.parent = parent
|
||||
self.score = added_score
|
||||
if self.parent is not None:
|
||||
self.score += self.parent.score
|
||||
self.transactions = transactions
|
||||
self.hash = BlockHash()
|
||||
if not allow_invalid:
|
||||
self.assert_noncontextually_valid()
|
||||
|
||||
def assert_noncontextually_valid(self) -> None:
|
||||
"""Assert that non-contextual consensus rules are satisfied for this block."""
|
||||
assert len(self.transactions) > 0
|
||||
assert self.transactions[0].is_coinbase()
|
||||
assert not any((tx.is_coinbase() for tx in islice(self.transactions, 1, None)))
|
||||
assert sum((tx.fee for tx in self.transactions)) == 0
|
||||
|
||||
def is_noncontextually_valid(self) -> bool:
|
||||
"""Are non-contextual consensus rules satisfied for this block?"""
|
||||
try:
|
||||
self.assert_noncontextually_valid()
|
||||
return True
|
||||
except AssertionError:
|
||||
return False
|
||||
|
||||
|
||||
@dataclass
|
||||
class BCProtocol:
|
||||
"""A best-chain protocol."""
|
||||
|
||||
Transaction: TypeAlias = BCTransaction
|
||||
"""The type of transactions for this protocol."""
|
||||
|
||||
Context: TypeAlias = BCContext
|
||||
"""The type of contexts for this protocol."""
|
||||
|
||||
Block: TypeAlias = BCBlock
|
||||
"""The type of blocks for this protocol."""
|
||||
|
||||
|
||||
__all__ = ['BCTransaction', 'BCContext', 'BCBlock', 'BCProtocol', 'BlockHash', 'Spentness']
|
||||
|
||||
|
||||
import unittest
|
||||
|
||||
|
||||
class TestBC(unittest.TestCase):
|
||||
def test_basic(self) -> None:
|
||||
ctx = BCContext()
|
||||
coinbase_tx0 = BCTransaction([], [10], [], [], 0, issuance=10)
|
||||
self.assertTrue(ctx.add_if_valid(coinbase_tx0))
|
||||
genesis = BCBlock(None, 1, [coinbase_tx0])
|
||||
self.assertEqual(genesis.score, 1)
|
||||
self.assertEqual(ctx.total_issuance, 10)
|
||||
|
||||
coinbase_tx1 = BCTransaction([], [6], [], [], -1, issuance=5)
|
||||
spend_tx = BCTransaction([coinbase_tx0.transparent_output(0)], [9], [], [], 1)
|
||||
self.assertTrue(ctx.add_if_valid(coinbase_tx1))
|
||||
self.assertTrue(ctx.add_if_valid(spend_tx))
|
||||
block1 = BCBlock(genesis, 1, [coinbase_tx1, spend_tx])
|
||||
self.assertEqual(block1.score, 2)
|
||||
self.assertEqual(ctx.total_issuance, 15)
|
||||
|
||||
coinbase_tx2 = BCTransaction([], [6], [], [], -1, issuance=5)
|
||||
shielding_tx = BCTransaction([coinbase_tx1.transparent_output(0), spend_tx.transparent_output(0)],
|
||||
[], [], [8, 6], 1)
|
||||
self.assertTrue(ctx.add_if_valid(coinbase_tx2))
|
||||
self.assertTrue(ctx.add_if_valid(shielding_tx))
|
||||
block2 = BCBlock(block1, 2, [coinbase_tx2, shielding_tx])
|
||||
block2_anchor = ctx.copy()
|
||||
self.assertEqual(block2.score, 4)
|
||||
self.assertEqual(ctx.total_issuance, 20)
|
||||
|
||||
coinbase_tx3 = BCTransaction([], [7], [], [], -2, issuance=5)
|
||||
shielded_tx = BCTransaction([], [], [shielding_tx.shielded_output(0)], [7], 1,
|
||||
anchor=block2_anchor)
|
||||
deshielding_tx = BCTransaction([], [5], [shielding_tx.shielded_output(1)], [], 1,
|
||||
anchor=block2_anchor)
|
||||
self.assertTrue(ctx.add_if_valid(coinbase_tx3))
|
||||
self.assertTrue(ctx.add_if_valid(shielded_tx))
|
||||
self.assertTrue(ctx.add_if_valid(deshielding_tx))
|
||||
block3 = BCBlock(block2, 3, [coinbase_tx3, shielded_tx, deshielding_tx])
|
||||
self.assertEqual(block3.score, 7)
|
||||
self.assertEqual(ctx.total_issuance, 25)
|
|
@ -7,168 +7,6 @@ modified in [Crosslink]). It might not be sufficient for other BFT
|
|||
protocols — but that's okay; it's a prototype.
|
||||
|
||||
[CS2020] https://eprint.iacr.org/2020/088.pdf
|
||||
|
||||
[Crosslink] https://hackmd.io/JqENg--qSmyqRt_RqY7Whw?view
|
||||
"""
|
||||
|
||||
|
||||
from __future__ import annotations
|
||||
|
||||
|
||||
def two_thirds_threshold(n: int) -> int:
|
||||
"""
|
||||
Calculate the notarization threshold used in most permissioned BFT protocols:
|
||||
`ceiling(n * 2/3)`.
|
||||
"""
|
||||
return (n * 2 + 2) // 3
|
||||
|
||||
|
||||
class PermissionedBFTBase:
|
||||
"""
|
||||
This class is used for the genesis block in a permissioned BFT protocol
|
||||
(which is taken to be notarized, and therefore valid, by definition).
|
||||
|
||||
It is also used as a base class for other BFT block and proposal classes.
|
||||
"""
|
||||
def __init__(self, n: int, t: int):
|
||||
"""
|
||||
Constructs a genesis block for a permissioned BFT protocol with
|
||||
`n` nodes, of which at least `t` must sign each proposal.
|
||||
"""
|
||||
self.n = n
|
||||
self.t = t
|
||||
self.parent = None
|
||||
|
||||
def last_final(self) -> PermissionedBFTBase:
|
||||
"""
|
||||
Returns the last final block in this block's ancestor chain.
|
||||
For the genesis block, this is itself.
|
||||
"""
|
||||
return self
|
||||
|
||||
|
||||
class PermissionedBFTBlock(PermissionedBFTBase):
|
||||
"""
|
||||
A block for a BFT protocol. Each non-genesis block is based on a
|
||||
notarized proposal, and in practice consists of the proposer's signature
|
||||
over the notarized proposal.
|
||||
|
||||
Honest proposers must only ever sign at most one valid proposal for the
|
||||
given epoch in which they are a proposer.
|
||||
|
||||
BFT blocks are taken to be notarized, and therefore valid, by definition.
|
||||
"""
|
||||
|
||||
def __init__(self, proposal: PermissionedBFTProposal):
|
||||
"""Constructs a `PermissionedBFTBlock` for the given proposal."""
|
||||
super().__init__(proposal.n, proposal.t)
|
||||
|
||||
proposal.assert_notarized()
|
||||
self.proposal = proposal
|
||||
self.parent = proposal.parent
|
||||
|
||||
def last_final(self):
|
||||
"""
|
||||
Returns the last final block in this block's ancestor chain.
|
||||
This should be overridden by subclasses; the default implementation
|
||||
will (inefficiently) just return the genesis block.
|
||||
"""
|
||||
return self if self.parent is None else self.parent.last_final()
|
||||
|
||||
|
||||
class PermissionedBFTProposal(PermissionedBFTBase):
|
||||
"""A proposal for a BFT protocol."""
|
||||
|
||||
def __init__(self, parent: PermissionedBFTBase):
|
||||
"""
|
||||
Constructs a `PermissionedBFTProposal` with the given parent
|
||||
`PermissionedBFTBlock`. The parameters are determined by the parent
|
||||
block.
|
||||
"""
|
||||
super().__init__(parent.n, parent.t)
|
||||
self.parent = parent
|
||||
self.signers = set()
|
||||
|
||||
def assert_valid(self) -> None:
|
||||
"""
|
||||
Assert that this proposal is valid. This does not assert that it is
|
||||
notarized. This should be overridden by subclasses.
|
||||
"""
|
||||
pass
|
||||
|
||||
def is_valid(self) -> bool:
|
||||
"""Is this proposal valid?"""
|
||||
try:
|
||||
self.assert_valid()
|
||||
return True
|
||||
except AssertionError:
|
||||
return False
|
||||
|
||||
def assert_notarized(self) -> None:
|
||||
"""
|
||||
Assert that this proposal is notarized. A `PermissionedBFTProposal`
|
||||
is notarized iff it is valid and has at least the threshold number of
|
||||
signatures.
|
||||
"""
|
||||
self.assert_valid()
|
||||
assert len(self.signers) >= self.t
|
||||
|
||||
def is_notarized(self) -> bool:
|
||||
"""Is this proposal notarized?"""
|
||||
try:
|
||||
self.assert_notarized()
|
||||
return True
|
||||
except AssertionError:
|
||||
return False
|
||||
|
||||
def add_signature(self, index: int) -> None:
|
||||
"""
|
||||
Record that the node with the given `index` has signed this proposal.
|
||||
If the same node signs more than once, the subsequent signatures are
|
||||
ignored.
|
||||
"""
|
||||
self.signers.add(index)
|
||||
assert len(self.signers) <= self.n
|
||||
|
||||
|
||||
__all__ = ['two_thirds_threshold', 'PermissionedBFTBase', 'PermissionedBFTBlock', 'PermissionedBFTProposal']
|
||||
|
||||
import unittest
|
||||
|
||||
|
||||
class TestPermissionedBFT(unittest.TestCase):
|
||||
def test_basic(self) -> None:
|
||||
# Construct the genesis block.
|
||||
genesis = PermissionedBFTBase(5, 2)
|
||||
current = genesis
|
||||
self.assertEqual(current.last_final(), genesis)
|
||||
|
||||
for _ in range(2):
|
||||
proposal = PermissionedBFTProposal(current)
|
||||
proposal.assert_valid()
|
||||
self.assertTrue(proposal.is_valid())
|
||||
self.assertFalse(proposal.is_notarized())
|
||||
|
||||
# not enough signatures
|
||||
proposal.add_signature(0)
|
||||
self.assertFalse(proposal.is_notarized())
|
||||
|
||||
# same index, so we still only have one signature
|
||||
proposal.add_signature(0)
|
||||
self.assertFalse(proposal.is_notarized())
|
||||
|
||||
# different index, now we have two signatures as required
|
||||
proposal.add_signature(1)
|
||||
proposal.assert_notarized()
|
||||
self.assertTrue(proposal.is_notarized())
|
||||
|
||||
current = PermissionedBFTBlock(proposal)
|
||||
self.assertEqual(current.last_final(), genesis)
|
||||
|
||||
def test_assertions(self) -> None:
|
||||
genesis = PermissionedBFTBase(5, 2)
|
||||
proposal = PermissionedBFTProposal(genesis)
|
||||
self.assertRaises(AssertionError, PermissionedBFTBlock, proposal)
|
||||
proposal.add_signature(0)
|
||||
self.assertRaises(AssertionError, PermissionedBFTBlock, proposal)
|
||||
proposal.add_signature(1)
|
||||
_ = PermissionedBFTBlock(proposal)
|
||||
|
|
|
@ -0,0 +1,209 @@
|
|||
"""
|
||||
Abstractions for Byzantine Fault-Tolerant protocols.
|
||||
"""
|
||||
|
||||
|
||||
from __future__ import annotations
|
||||
|
||||
|
||||
def two_thirds_threshold(n: int) -> int:
|
||||
"""
|
||||
Calculate the notarization threshold used in most permissioned BFT protocols:
|
||||
`ceiling(n * 2/3)`.
|
||||
"""
|
||||
return (n * 2 + 2) // 3
|
||||
|
||||
|
||||
class PermissionedBFTBase:
|
||||
"""
|
||||
This class is used for the genesis block in a permissioned BFT protocol
|
||||
(which is taken to be notarized, and therefore valid, by definition).
|
||||
|
||||
It is also used as a base class for other BFT block and proposal classes.
|
||||
"""
|
||||
def __init__(self, n: int, t: int):
|
||||
"""
|
||||
Constructs a genesis block for a permissioned BFT protocol with
|
||||
`n` nodes, of which at least `t` must sign each proposal.
|
||||
"""
|
||||
|
||||
self.n = n
|
||||
"""The number of voters."""
|
||||
|
||||
self.t = t
|
||||
"""The threshold of votes required for notarization."""
|
||||
|
||||
self.parent = None
|
||||
"""The genesis block has no parent (represented as `None`)."""
|
||||
|
||||
self.length = 1
|
||||
"""The genesis chain length is 1."""
|
||||
|
||||
self.last_final = self
|
||||
"""The last final block for the genesis block is itself."""
|
||||
|
||||
def preceq(self, other: PermissionedBFTBase):
|
||||
"""Return True if this block is an ancestor of `other`."""
|
||||
if self.length > other.length:
|
||||
return False # optimization
|
||||
return self == other or (other.parent is not None and self.preceq(other.parent))
|
||||
|
||||
def __eq__(self, other) -> bool:
|
||||
return other.parent is None and (self.n, self.t) == (other.n, other.t)
|
||||
|
||||
def __hash__(self) -> int:
|
||||
return hash((self.n, self.t))
|
||||
|
||||
|
||||
class PermissionedBFTBlock(PermissionedBFTBase):
|
||||
"""
|
||||
A block for a BFT protocol. Each non-genesis block is based on a
|
||||
notarized proposal, and in practice consists of the proposer's signature
|
||||
over the notarized proposal.
|
||||
|
||||
Honest proposers must only ever sign at most one valid proposal for the
|
||||
given epoch in which they are a proposer.
|
||||
|
||||
BFT blocks are taken to be notarized, and therefore valid, by definition.
|
||||
"""
|
||||
|
||||
def __init__(self, proposal: PermissionedBFTProposal):
|
||||
"""Constructs a `PermissionedBFTBlock` for the given proposal."""
|
||||
super().__init__(proposal.n, proposal.t)
|
||||
|
||||
proposal.assert_notarized()
|
||||
self.proposal = proposal
|
||||
"""The proposal for this block."""
|
||||
|
||||
assert proposal.parent is not None
|
||||
self.parent = proposal.parent
|
||||
"""The parent of this block."""
|
||||
|
||||
self.length = proposal.length
|
||||
"""The chain length of this block."""
|
||||
|
||||
self.last_final = self.parent.last_final
|
||||
"""The last final block for this block."""
|
||||
|
||||
def __eq__(self, other) -> bool:
|
||||
return (isinstance(other, PermissionedBFTBlock) and
|
||||
(self.n, self.t, self.proposal) == (other.n, other.t, other.proposal))
|
||||
|
||||
def __hash__(self) -> int:
|
||||
return hash((self.n, self.t, self.proposal))
|
||||
|
||||
|
||||
class PermissionedBFTProposal(PermissionedBFTBase):
|
||||
"""A proposal for a BFT protocol."""
|
||||
|
||||
def __init__(self, parent: PermissionedBFTBase):
|
||||
"""
|
||||
Constructs a `PermissionedBFTProposal` with the given parent
|
||||
`PermissionedBFTBlock`. The parameters are determined by the parent
|
||||
block.
|
||||
"""
|
||||
super().__init__(parent.n, parent.t)
|
||||
|
||||
self.parent = parent
|
||||
"""The parent block of this proposal."""
|
||||
|
||||
self.length = parent.length + 1
|
||||
"""The chain length of this proposal is one greater than its parent block."""
|
||||
|
||||
self.votes = set()
|
||||
"""The set of voter indices that have voted for this proposal."""
|
||||
|
||||
def __eq__(self, other):
|
||||
"""Two proposals are equal iff they are the same object."""
|
||||
return self is other
|
||||
|
||||
def __hash__(self) -> int:
|
||||
return id(self)
|
||||
|
||||
def assert_valid(self) -> None:
|
||||
"""
|
||||
Assert that this proposal is valid. This does not assert that it is
|
||||
notarized. This should be overridden by subclasses.
|
||||
"""
|
||||
pass
|
||||
|
||||
def is_valid(self) -> bool:
|
||||
"""Is this proposal valid?"""
|
||||
try:
|
||||
self.assert_valid()
|
||||
return True
|
||||
except AssertionError:
|
||||
return False
|
||||
|
||||
def assert_notarized(self) -> None:
|
||||
"""
|
||||
Assert that this proposal is notarized. A `PermissionedBFTProposal`
|
||||
is notarized iff it is valid and has at least the threshold number of
|
||||
signatures.
|
||||
"""
|
||||
self.assert_valid()
|
||||
assert len(self.votes) >= self.t
|
||||
|
||||
def is_notarized(self) -> bool:
|
||||
"""Is this proposal notarized?"""
|
||||
try:
|
||||
self.assert_notarized()
|
||||
return True
|
||||
except AssertionError:
|
||||
return False
|
||||
|
||||
def add_vote(self, index: int) -> None:
|
||||
"""
|
||||
Record that the node with the given `index` has voted for this proposal.
|
||||
Calls that add the same vote more than once are ignored.
|
||||
"""
|
||||
self.votes.add(index)
|
||||
assert len(self.votes) <= self.n
|
||||
|
||||
|
||||
__all__ = ['two_thirds_threshold', 'PermissionedBFTBase', 'PermissionedBFTBlock', 'PermissionedBFTProposal']
|
||||
|
||||
import unittest
|
||||
|
||||
|
||||
class TestPermissionedBFT(unittest.TestCase):
|
||||
def test_basic(self) -> None:
|
||||
# Construct the genesis block.
|
||||
genesis = PermissionedBFTBase(5, 2)
|
||||
current = genesis
|
||||
self.assertEqual(current.last_final, genesis)
|
||||
|
||||
for _ in range(2):
|
||||
parent = current
|
||||
proposal = PermissionedBFTProposal(parent)
|
||||
proposal.assert_valid()
|
||||
self.assertTrue(proposal.is_valid())
|
||||
self.assertFalse(proposal.is_notarized())
|
||||
|
||||
# not enough votes
|
||||
proposal.add_vote(0)
|
||||
self.assertFalse(proposal.is_notarized())
|
||||
|
||||
# same index, so we still only have one vote
|
||||
proposal.add_vote(0)
|
||||
self.assertFalse(proposal.is_notarized())
|
||||
|
||||
# different index, now we have two votes as required
|
||||
proposal.add_vote(1)
|
||||
proposal.assert_notarized()
|
||||
self.assertTrue(proposal.is_notarized())
|
||||
|
||||
current = PermissionedBFTBlock(proposal)
|
||||
self.assertTrue(parent.preceq(current))
|
||||
self.assertFalse(current.preceq(parent))
|
||||
self.assertNotEqual(current, parent)
|
||||
self.assertEqual(current.last_final, genesis)
|
||||
|
||||
def test_assertions(self) -> None:
|
||||
genesis = PermissionedBFTBase(5, 2)
|
||||
proposal = PermissionedBFTProposal(genesis)
|
||||
self.assertRaises(AssertionError, PermissionedBFTBlock, proposal)
|
||||
proposal.add_vote(0)
|
||||
self.assertRaises(AssertionError, PermissionedBFTBlock, proposal)
|
||||
proposal.add_vote(1)
|
||||
_ = PermissionedBFTBlock(proposal)
|
|
@ -2,179 +2,6 @@
|
|||
An implementation of adapted-Streamlet ([CS2020] as modified in [Crosslink]).
|
||||
|
||||
[CS2020] https://eprint.iacr.org/2020/088.pdf
|
||||
|
||||
[Crosslink] https://hackmd.io/JqENg--qSmyqRt_RqY7Whw?view
|
||||
"""
|
||||
|
||||
|
||||
from __future__ import annotations
|
||||
from typing import Optional
|
||||
from collections.abc import Sequence
|
||||
|
||||
from .. import PermissionedBFTBase, PermissionedBFTBlock, PermissionedBFTProposal, \
|
||||
two_thirds_threshold
|
||||
|
||||
|
||||
class StreamletProposal(PermissionedBFTProposal):
|
||||
"""An adapted-Streamlet proposal."""
|
||||
|
||||
def __init__(self, parent: StreamletBlock | StreamletGenesis, epoch: int):
|
||||
"""
|
||||
Constructs a `StreamletProposal` with the given parent `StreamletBlock`,
|
||||
for the given `epoch`. The parameters are determined by the parent block.
|
||||
A proposal must be for an epoch after its parent's epoch.
|
||||
"""
|
||||
super().__init__(parent)
|
||||
assert epoch > parent.epoch
|
||||
self.epoch = epoch
|
||||
"""The epoch of this proposal."""
|
||||
|
||||
def __repr__(self) -> str:
|
||||
return "StreamletProposal(parent=%r, epoch=%r)" % (self.parent, self.epoch)
|
||||
|
||||
|
||||
class StreamletGenesis(PermissionedBFTBase):
|
||||
"""An adapted-Streamlet genesis block."""
|
||||
|
||||
def __init__(self, n: int):
|
||||
"""
|
||||
Constructs a genesis block for adapted-Streamlet with `n` nodes.
|
||||
"""
|
||||
super().__init__(n, two_thirds_threshold(n))
|
||||
self.epoch = 0
|
||||
"""The genesis block has epoch 0."""
|
||||
|
||||
def __repr__(self) -> str:
|
||||
return "StreamletGenesis(n=%r)" % (self.n,)
|
||||
|
||||
|
||||
class StreamletBlock(PermissionedBFTBlock):
|
||||
"""
|
||||
An adapted-Streamlet block. Each non-genesis Streamlet block is
|
||||
based on a notarized `StreamletProposal`.
|
||||
|
||||
`StreamletBlock`s are taken to be notarized by definition.
|
||||
All validity conditions are enforced in the contructor.
|
||||
"""
|
||||
|
||||
def __init__(self, proposal: StreamletProposal):
|
||||
"""Constructs a `StreamletBlock` for the given proposal."""
|
||||
super().__init__(proposal)
|
||||
self.epoch = proposal.epoch
|
||||
|
||||
def last_final(self) -> StreamletBlock | StreamletGenesis:
|
||||
"""
|
||||
Returns the last final block in this block's ancestor chain.
|
||||
In Streamlet this is the middle block of the last group of three
|
||||
that were proposed in consecutive epochs.
|
||||
"""
|
||||
last = self
|
||||
if last.parent is None:
|
||||
return last
|
||||
middle = last.parent
|
||||
if middle.parent is None:
|
||||
return middle
|
||||
first = middle.parent
|
||||
while True:
|
||||
if first.parent is None:
|
||||
return first
|
||||
if (first.epoch + 1, middle.epoch + 1) == (middle.epoch, last.epoch):
|
||||
return middle
|
||||
(first, middle, last) = (first.parent, first, middle)
|
||||
|
||||
def __repr__(self) -> str:
|
||||
return "StreamletBlock(proposal=%r)" % (self.proposal,)
|
||||
|
||||
|
||||
import unittest
|
||||
from itertools import count
|
||||
|
||||
|
||||
class TestStreamlet(unittest.TestCase):
|
||||
def test_simple(self) -> None:
|
||||
"""
|
||||
Very simple example.
|
||||
|
||||
0 --- 1 --- 2 --- 3
|
||||
"""
|
||||
self._test_last_final([0, 1, 2], [0, 0, 2])
|
||||
|
||||
def test_figure_1(self) -> None:
|
||||
"""
|
||||
Figure 1: Streamlet finalization example (without the invalid 'X' proposal).
|
||||
|
||||
0 --- 2 --- 5 --- 6 --- 7
|
||||
\
|
||||
-- 1 --- 3
|
||||
|
||||
0 - Genesis
|
||||
N - Notarized block
|
||||
|
||||
This diagram implies the epoch 6 block is the last-final block in the
|
||||
context of the epoch 7 block, because it is in the middle of 3 blocks
|
||||
with consecutive epoch numbers, and 6 is the most recent such block.
|
||||
|
||||
(We don't include the block/proposal with the red X because that's not
|
||||
what we're testing.)
|
||||
"""
|
||||
self._test_last_final([0, 0, 1, None, 2, 5, 6], [0, 0, 0, 0, 0, 0, 6])
|
||||
|
||||
def test_complex(self) -> None:
|
||||
"""
|
||||
Safety Violation: due to three simultaneous properties:
|
||||
|
||||
- 6 is `last_final` in the context of 7
|
||||
- 9 is `last_final` in the context of 10
|
||||
- 9 is not a descendant of 6
|
||||
|
||||
0 --- 2 --- 5 --- 6 --- 7
|
||||
\
|
||||
-- 1 --- 3 --- 8 --- 9 --- 10
|
||||
"""
|
||||
self._test_last_final([0, 0, 1, None, 2, 5, 6, 3, 8, 9], [0, 0, 0, 0, 0, 0, 6, 0, 0, 9])
|
||||
|
||||
def _test_last_final(self, parent_map: Sequence[Optional[int]], final_map: Sequence[int]) -> None:
|
||||
"""
|
||||
This test constructs a tree of proposals with structure determined by
|
||||
`parent_map`, and asserts `block.last_final()` matches the structure
|
||||
determined by `final_map`.
|
||||
|
||||
parent_map: sequence of parent epoch numbers
|
||||
final_map: sequence of final epoch numbers
|
||||
"""
|
||||
|
||||
assert len(parent_map) == len(final_map)
|
||||
|
||||
# Construct the genesis block.
|
||||
genesis = StreamletGenesis(3)
|
||||
current = genesis
|
||||
self.assertEqual(current.last_final(), genesis)
|
||||
blocks = [genesis]
|
||||
|
||||
for (epoch, parent_epoch, final_epoch) in zip(count(1), parent_map, final_map):
|
||||
if parent_epoch is None:
|
||||
blocks.append(None)
|
||||
continue
|
||||
|
||||
parent = blocks[parent_epoch]
|
||||
assert parent is not None
|
||||
proposal = StreamletProposal(parent, epoch)
|
||||
proposal.assert_valid()
|
||||
self.assertTrue(proposal.is_valid())
|
||||
self.assertFalse(proposal.is_notarized())
|
||||
|
||||
# not enough signatures
|
||||
proposal.add_signature(0)
|
||||
self.assertFalse(proposal.is_notarized())
|
||||
|
||||
# same index, so we still only have one signature
|
||||
proposal.add_signature(0)
|
||||
self.assertFalse(proposal.is_notarized())
|
||||
|
||||
# different index, now we have two signatures as required
|
||||
proposal.add_signature(1)
|
||||
proposal.assert_notarized()
|
||||
self.assertTrue(proposal.is_notarized())
|
||||
|
||||
current = StreamletBlock(proposal)
|
||||
blocks.append(current)
|
||||
self.assertEqual(current.last_final(), blocks[final_epoch])
|
||||
|
|
|
@ -0,0 +1,100 @@
|
|||
"""
|
||||
Adapted-Streamlet chain classes.
|
||||
"""
|
||||
|
||||
|
||||
from __future__ import annotations
|
||||
from typing import Optional
|
||||
|
||||
from ..chain import PermissionedBFTBase, PermissionedBFTBlock, PermissionedBFTProposal, \
|
||||
two_thirds_threshold
|
||||
|
||||
|
||||
class StreamletProposal(PermissionedBFTProposal):
|
||||
"""An adapted-Streamlet proposal."""
|
||||
|
||||
def __init__(self, parent: StreamletBlock | StreamletGenesis, epoch: int):
|
||||
"""
|
||||
Constructs a `StreamletProposal` with the given parent `StreamletBlock`,
|
||||
for the given `epoch`. The parameters are determined by the parent block.
|
||||
A proposal must be for an epoch after its parent's epoch.
|
||||
"""
|
||||
super().__init__(parent)
|
||||
self.parent: StreamletBlock | StreamletGenesis = parent
|
||||
|
||||
assert epoch > parent.epoch
|
||||
self.epoch = epoch
|
||||
"""The epoch of this proposal."""
|
||||
|
||||
def __str__(self) -> str:
|
||||
return f"StreamletProposal(parent={self.parent}, epoch={self.epoch}, length={self.length})"
|
||||
|
||||
|
||||
class StreamletGenesis(PermissionedBFTBase):
|
||||
"""An adapted-Streamlet genesis block."""
|
||||
|
||||
def __init__(self, n: int):
|
||||
"""
|
||||
Constructs a genesis block for adapted-Streamlet with `n` nodes.
|
||||
"""
|
||||
super().__init__(n, two_thirds_threshold(n))
|
||||
|
||||
self.parent: Optional[StreamletBlock | StreamletGenesis] = None
|
||||
"""The genesis block has no parent (represented as `None`)."""
|
||||
|
||||
self.epoch = 0
|
||||
"""The epoch of the genesis block is 0."""
|
||||
|
||||
self.last_final = self
|
||||
"""The last final block of the genesis block is itself."""
|
||||
|
||||
def __str__(self) -> str:
|
||||
return f"StreamletGenesis(n={self.n})"
|
||||
|
||||
def proposer_for_epoch(self, epoch: int):
|
||||
assert epoch > 0
|
||||
return (epoch - 1) % self.n
|
||||
|
||||
|
||||
class StreamletBlock(PermissionedBFTBlock):
|
||||
"""
|
||||
An adapted-Streamlet block. Each non-genesis Streamlet block is
|
||||
based on a notarized `StreamletProposal`.
|
||||
|
||||
`StreamletBlock`s are taken to be notarized by definition.
|
||||
All validity conditions are enforced in the contructor.
|
||||
"""
|
||||
|
||||
def __init__(self, proposal: StreamletProposal):
|
||||
"""Constructs a `StreamletBlock` for the given proposal."""
|
||||
super().__init__(proposal)
|
||||
|
||||
self.epoch = proposal.epoch
|
||||
"""The epoch of this proposal."""
|
||||
|
||||
self.parent: StreamletBlock | StreamletGenesis = proposal.parent
|
||||
|
||||
self.last_final = self._compute_last_final()
|
||||
"""
|
||||
The last final block in this block's ancestor chain.
|
||||
In Streamlet this is the middle block of the last group of three
|
||||
that were proposed in consecutive epochs.
|
||||
"""
|
||||
|
||||
def _compute_last_final(self) -> StreamletBlock | StreamletGenesis:
|
||||
last: StreamletBlock | StreamletGenesis = self
|
||||
if last.parent is None:
|
||||
return last
|
||||
middle: StreamletBlock | StreamletGenesis = last.parent
|
||||
if middle.parent is None:
|
||||
return middle
|
||||
first: StreamletBlock | StreamletGenesis = middle.parent
|
||||
while True:
|
||||
if first.parent is None:
|
||||
return first
|
||||
if (first.epoch + 1, middle.epoch + 1) == (middle.epoch, last.epoch):
|
||||
return middle
|
||||
(first, middle, last) = (first.parent, first, middle)
|
||||
|
||||
def __str__(self) -> str:
|
||||
return f"StreamletBlock(proposal={self.proposal})"
|
|
@ -4,12 +4,15 @@ An adapted-Streamlet node.
|
|||
|
||||
|
||||
from __future__ import annotations
|
||||
from typing import Optional
|
||||
from collections.abc import Sequence
|
||||
from dataclasses import dataclass
|
||||
|
||||
from ...node import SequentialNode
|
||||
from ...message import Message, PayloadMessage
|
||||
from ...util import skip, ProcessEffect
|
||||
|
||||
from . import StreamletGenesis, StreamletBlock, StreamletProposal
|
||||
from .chain import StreamletGenesis, StreamletBlock, StreamletProposal
|
||||
|
||||
|
||||
class Echo(PayloadMessage):
|
||||
|
@ -20,6 +23,35 @@ class Echo(PayloadMessage):
|
|||
pass
|
||||
|
||||
|
||||
@dataclass(frozen=True)
|
||||
class Ballot(Message):
|
||||
"""
|
||||
A ballot message, recording that a voter has voted for a `StreamletProposal`.
|
||||
Ballots should not be forged unless modelling an attack that allows doing so.
|
||||
"""
|
||||
proposal: StreamletProposal
|
||||
"""The proposal."""
|
||||
voter: int
|
||||
"""The voter."""
|
||||
|
||||
def __str__(self) -> str:
|
||||
return f"Ballot({self.proposal}, voter={self.voter})"
|
||||
|
||||
|
||||
class Proposal(PayloadMessage):
|
||||
"""
|
||||
A message containing a `StreamletProposal`.
|
||||
"""
|
||||
pass
|
||||
|
||||
|
||||
class Block(PayloadMessage):
|
||||
"""
|
||||
A message containing a `StreamletBlock`.
|
||||
"""
|
||||
pass
|
||||
|
||||
|
||||
class StreamletNode(SequentialNode):
|
||||
"""
|
||||
A Streamlet node.
|
||||
|
@ -32,7 +64,32 @@ class StreamletNode(SequentialNode):
|
|||
"""
|
||||
assert genesis.epoch == 0
|
||||
self.genesis = genesis
|
||||
"""The genesis block."""
|
||||
|
||||
self.voted_epoch = genesis.epoch
|
||||
"""The last epoch on which this node voted."""
|
||||
|
||||
self.tip: StreamletBlock | StreamletGenesis = genesis
|
||||
"""
|
||||
A longest chain seen by this node. The node's last final block is given by
|
||||
`self.tip.last_final`.
|
||||
"""
|
||||
|
||||
self.proposal: Optional[StreamletProposal] = None
|
||||
"""The current proposal by this node, when it is the proposer."""
|
||||
|
||||
self.safety_violations: set[tuple[StreamletBlock | StreamletGenesis,
|
||||
StreamletBlock | StreamletGenesis]] = set()
|
||||
"""The set of safety violations detected by this node."""
|
||||
|
||||
def propose(self, proposal: StreamletProposal) -> ProcessEffect:
|
||||
"""
|
||||
(process) Ask the node to make a proposal.
|
||||
"""
|
||||
assert proposal.is_valid()
|
||||
assert proposal.epoch > self.voted_epoch
|
||||
self.proposal = proposal
|
||||
return self.broadcast(Proposal(proposal), False)
|
||||
|
||||
def handle(self, sender: int, message: Message) -> ProcessEffect:
|
||||
"""
|
||||
|
@ -42,32 +99,242 @@ class StreamletNode(SequentialNode):
|
|||
(This causes the number of messages to blow up by a factor of `n`,
|
||||
but it's what the Streamlet paper specifies and is necessary for
|
||||
its liveness proof.)
|
||||
* Received non-duplicate proposals may cause us to send a `Vote`.
|
||||
* ...
|
||||
* Receiving a non-duplicate `Proposal` may cause us to broadcast a `Ballot`.
|
||||
* If we are the current proposer, keep track of ballots for our proposal.
|
||||
* Receiving a `Block` may cause us to update our `tip`.
|
||||
"""
|
||||
if isinstance(message, Echo):
|
||||
message = message.payload
|
||||
else:
|
||||
yield from self.broadcast(Echo(message))
|
||||
yield from self.broadcast(Echo(message), False)
|
||||
|
||||
if isinstance(message, StreamletProposal):
|
||||
yield from self.handle_proposal(message)
|
||||
elif isinstance(message, StreamletBlock):
|
||||
yield from self.handle_block(message)
|
||||
if isinstance(message, Proposal):
|
||||
yield from self.handle_proposal(message.payload)
|
||||
elif isinstance(message, Block):
|
||||
yield from self.handle_block(message.payload)
|
||||
elif isinstance(message, Ballot):
|
||||
yield from self.handle_ballot(message)
|
||||
else:
|
||||
yield from super().handle(sender, message)
|
||||
|
||||
def handle_proposal(self, proposal: StreamletProposal) -> ProcessEffect:
|
||||
"""
|
||||
(process) If we already voted in the epoch specified by the proposal or a
|
||||
later epoch, ignore this proposal.
|
||||
later epoch, ignore this proposal. Otherwise, cast a vote for it iff it
|
||||
is valid.
|
||||
"""
|
||||
if proposal.epoch <= self.voted_epoch:
|
||||
self.log("handle",
|
||||
self.log("proposal",
|
||||
f"received proposal for epoch {proposal.epoch} but we already voted in epoch {self.voted_epoch}")
|
||||
return skip()
|
||||
|
||||
return skip()
|
||||
if proposal.is_valid():
|
||||
self.log("proposal", f"voting for {proposal}")
|
||||
# For now we just forget that we made a proposal if we receive a different
|
||||
# valid one from another node. This is not realistic. Note that we can and
|
||||
# should vote for our own proposal.
|
||||
if proposal != self.proposal:
|
||||
self.proposal = None
|
||||
|
||||
self.voted_epoch = proposal.epoch
|
||||
return self.broadcast(Ballot(proposal, self.ident), True)
|
||||
else:
|
||||
return skip()
|
||||
|
||||
def handle_block(self, block: StreamletBlock) -> ProcessEffect:
|
||||
raise NotImplementedError
|
||||
"""
|
||||
If `block.last_final` does not descend from `self.tip.last_final`, reject the block.
|
||||
(In this case, if also `self.tip.last_final` does not descend from `block.last_final`,
|
||||
this is a detected safety violation.)
|
||||
|
||||
Otherwise, update `self.tip` to `block` iff `block` is later in lexicographic ordering
|
||||
by `(length, epoch)`.
|
||||
"""
|
||||
if not self.tip.last_final.preceq(block.last_final):
|
||||
self.log("block", f"× not ⪰ last_final: {block}")
|
||||
if not block.last_final.preceq(self.tip.last_final):
|
||||
self.log("block", f"! safety violation: ({block}, {self.tip})")
|
||||
self.safety_violations.add((block, self.tip))
|
||||
return skip()
|
||||
|
||||
# TODO: analyse tie-breaking rule.
|
||||
if (self.tip.length, self.tip.epoch) >= (block.length, block.epoch):
|
||||
self.log("block", f"× not updating tip: {block}")
|
||||
return skip()
|
||||
|
||||
self.log("block", f"✓ updating tip: {block}")
|
||||
self.tip = block
|
||||
return skip()
|
||||
|
||||
def handle_ballot(self, ballot: Ballot) -> ProcessEffect:
|
||||
"""
|
||||
If we have made a proposal that is not yet notarized and the ballot is
|
||||
for that proposal, add the vote. If it is now notarized, broadcast it
|
||||
as a block.
|
||||
"""
|
||||
proposal = ballot.proposal
|
||||
if proposal == self.proposal:
|
||||
self.log("count", f"{ballot.voter} voted for our proposal in epoch {proposal.epoch}")
|
||||
proposal.add_vote(ballot.voter)
|
||||
if proposal.is_notarized():
|
||||
yield from self.broadcast(Block(StreamletBlock(proposal)), True)
|
||||
# It's fine to forget that we made the proposal now.
|
||||
self.proposal = None
|
||||
|
||||
def final_block(self) -> StreamletBlock | StreamletGenesis:
|
||||
"""
|
||||
Return the last final block seen by this node.
|
||||
"""
|
||||
return self.tip.last_final
|
||||
|
||||
|
||||
__all__ = ['Echo', 'Ballot', 'StreamletNode']
|
||||
|
||||
import unittest
|
||||
from itertools import count
|
||||
from simpy import Environment
|
||||
from simpy.events import Process, Timeout
|
||||
|
||||
from ...network import Network
|
||||
from ...logging import PrintLogger
|
||||
|
||||
|
||||
class TestStreamlet(unittest.TestCase):
|
||||
def test_simple(self) -> None:
|
||||
"""
|
||||
Very simple example.
|
||||
|
||||
0 --- 1 --- 2 --- 3
|
||||
"""
|
||||
self._test_last_final([0, 1, 2],
|
||||
[0, 0, 2])
|
||||
|
||||
def test_figure_1(self) -> None:
|
||||
"""
|
||||
Figure 1: Streamlet finalization example (without the invalid 'X' proposal).
|
||||
|
||||
0 --- 2 --- 5 --- 6 --- 7
|
||||
\
|
||||
-- 1 --- 3
|
||||
|
||||
0 - Genesis
|
||||
N - Notarized block
|
||||
|
||||
This diagram implies the epoch 6 block is the last-final block in the
|
||||
context of the epoch 7 block, because it is in the middle of 3 blocks
|
||||
with consecutive epoch numbers, and 6 is the most recent such block.
|
||||
|
||||
(We don't include the block/proposal with the red X because that's not
|
||||
what we're testing.)
|
||||
"""
|
||||
N = None
|
||||
self._test_last_final([0, 0, 1, N, 2, 5, 6],
|
||||
[0, 0, 0, 0, 0, 0, 6])
|
||||
|
||||
def test_complex(self) -> None:
|
||||
"""
|
||||
Safety Violation: due to three simultaneous properties:
|
||||
|
||||
- 6 is `last_final` in the context of 7
|
||||
- 9 is `last_final` in the context of 10
|
||||
- 9 is not a descendant of 6
|
||||
|
||||
0 --- 2 --- 5 --- 6 --- 7
|
||||
\
|
||||
-- 1 --- 3 --- 8 --- 9 --- 10
|
||||
"""
|
||||
N = None
|
||||
self._test_last_final([0, 0, 1, N, 2, 5, 6, 3, 8, 9],
|
||||
[0, 0, 0, 0, 0, 0, 6, 0, 0, 9],
|
||||
expect_divergence_at_epoch=8,
|
||||
expect_safety_violations={(10, 7)})
|
||||
|
||||
def _test_last_final(self,
|
||||
parent_map: Sequence[Optional[int]],
|
||||
final_map: Sequence[int],
|
||||
expect_divergence_at_epoch: Optional[int]=None,
|
||||
expect_safety_violations: set[tuple[int, int]]=set()) -> None:
|
||||
"""
|
||||
This test constructs a tree of proposals with structure determined by
|
||||
`parent_map`, and asserts `block.last_final` matches the structure
|
||||
determined by `final_map`.
|
||||
|
||||
parent_map: sequence of parent epoch numbers
|
||||
final_map: sequence of final epoch numbers
|
||||
expect_divergence_at_epoch: first epoch at which a block does not become the new tip
|
||||
expect_safety_violations: safety violation proofs
|
||||
"""
|
||||
|
||||
assert len(parent_map) == len(final_map)
|
||||
|
||||
# Construct the genesis block.
|
||||
genesis = StreamletGenesis(3)
|
||||
network = Network(Environment(), logger=PrintLogger())
|
||||
for _ in range(genesis.n):
|
||||
network.add_node(StreamletNode(genesis))
|
||||
|
||||
current = genesis
|
||||
self.assertEqual(current.last_final, genesis)
|
||||
blocks: list[Optional[StreamletBlock | StreamletGenesis]] = [genesis]
|
||||
|
||||
def run() -> ProcessEffect:
|
||||
for (epoch, parent_epoch, final_epoch) in zip(count(1), parent_map, final_map):
|
||||
yield Timeout(network.env, 10)
|
||||
if parent_epoch is None:
|
||||
blocks.append(None)
|
||||
continue
|
||||
|
||||
parent = blocks[parent_epoch]
|
||||
assert parent is not None
|
||||
proposer = network.node(genesis.proposer_for_epoch(epoch))
|
||||
proposal = StreamletProposal(parent, epoch)
|
||||
self.assertEqual(proposal.length, parent.length + 1)
|
||||
proposal.assert_valid()
|
||||
self.assertFalse(proposal.is_notarized())
|
||||
|
||||
proposer.propose(proposal)
|
||||
yield Timeout(network.env, 10)
|
||||
|
||||
# The proposer should have sent the block.
|
||||
assert proposer.proposal is None
|
||||
|
||||
# Make a fake block `current` from the proposal so that we can append
|
||||
# it to `blocks` and check its `last_final`.
|
||||
current = StreamletBlock(proposal)
|
||||
self.assertEqual(current.length, proposal.length)
|
||||
self.assertTrue(parent.preceq(current))
|
||||
self.assertFalse(current.preceq(parent))
|
||||
self.assertEqual(len(blocks), current.epoch)
|
||||
blocks.append(current)
|
||||
final_block = blocks[final_epoch]
|
||||
assert final_block is not None
|
||||
self.assertEqual(current.last_final, final_block)
|
||||
|
||||
# All nodes' tips should be the same.
|
||||
tip = network.node(0).tip
|
||||
for i in range(1, network.num_nodes()):
|
||||
self.assertEqual(network.node(i).tip, tip)
|
||||
|
||||
# If we try to create a new block on top of a chain that is not the longest,
|
||||
# the nodes will ignore it.
|
||||
if epoch == expect_divergence_at_epoch:
|
||||
self.assertLess(current.length, tip.length)
|
||||
elif expect_divergence_at_epoch is None or epoch < expect_divergence_at_epoch:
|
||||
self.assertEqual(current.length, tip.length)
|
||||
self.assertEqual(tip.epoch, epoch)
|
||||
self.assertEqual(tip.proposal, proposal)
|
||||
|
||||
for node in network.nodes:
|
||||
node_final = node.final_block()
|
||||
self.assertEqual(node_final, final_block,
|
||||
f"epoch {node_final.epoch} != epoch {final_block.epoch}")
|
||||
|
||||
for node in network.nodes:
|
||||
self.assertEqual(set(((a.epoch, b.epoch) for (a, b) in node.safety_violations)),
|
||||
expect_safety_violations)
|
||||
|
||||
network.done = True
|
||||
|
||||
Process(network.env, run())
|
||||
network.run_all()
|
||||
self.assertTrue(network.done)
|
||||
|
|
|
@ -22,3 +22,6 @@ class PayloadMessage(Message):
|
|||
"""
|
||||
payload: Any
|
||||
"""The payload."""
|
||||
|
||||
def __str__(self) -> str:
|
||||
return f"{self.__class__.__name__}({self.payload})"
|
||||
|
|
|
@ -30,7 +30,7 @@ class Node:
|
|||
self.env = env
|
||||
self.network = network
|
||||
|
||||
def __str__(self):
|
||||
def __str__(self) -> str:
|
||||
return f"{self.__class__.__name__}"
|
||||
|
||||
def log(self, event: str, detail: str):
|
||||
|
@ -47,13 +47,13 @@ class Node:
|
|||
"""
|
||||
return self.network.send(self.ident, target, message, delay=delay)
|
||||
|
||||
def broadcast(self, message: Message, delay: Optional[Number]=None) -> ProcessEffect:
|
||||
def broadcast(self, message: Message, include_self: bool, delay: Optional[Number]=None) -> ProcessEffect:
|
||||
"""
|
||||
(process) This method can be overridden to intercept messages being broadcast
|
||||
by this node. The implementation in this class calls `self.network.broadcast`
|
||||
with this node as the sender.
|
||||
"""
|
||||
return self.network.broadcast(self.ident, message, delay=delay)
|
||||
return self.network.broadcast(self.ident, message, include_self, delay=delay)
|
||||
|
||||
def receive(self, sender: int, message: Message) -> ProcessEffect:
|
||||
"""
|
||||
|
@ -86,8 +86,14 @@ class Network:
|
|||
a set of initial nodes, message propagation delay, and logger.
|
||||
"""
|
||||
self.env = env
|
||||
"""The `simpy.Environment`."""
|
||||
|
||||
self.nodes = nodes or []
|
||||
"""The nodes in this network."""
|
||||
|
||||
self.delay = delay
|
||||
"""The message propagation delay."""
|
||||
|
||||
self._logger = logger
|
||||
logger.header()
|
||||
|
||||
|
@ -166,19 +172,21 @@ class Network:
|
|||
# TODO: make it take some time on the sending node.
|
||||
return skip()
|
||||
|
||||
def broadcast(self, sender: int, message: Message, delay: Optional[Number]=None) -> ProcessEffect:
|
||||
def broadcast(self, sender: int, message: Message, include_self: bool,
|
||||
delay: Optional[Number]=None) -> ProcessEffect:
|
||||
"""
|
||||
(process) Broadcasts a message to every other node. The message
|
||||
propagation delay is normally given by `self.delay`, but can be
|
||||
overridden by the `delay` parameter.
|
||||
(process) Broadcasts a message to every node (including ourself only when
|
||||
`include_self` is set). The message propagation delay is normally given by
|
||||
`self.delay`, but can be overridden by the `delay` parameter.
|
||||
"""
|
||||
if delay is None:
|
||||
delay = self.delay
|
||||
self.log(sender, "broadcast", f"to * with delay {delay:2d}: {message}")
|
||||
c = "+" if include_self else "-"
|
||||
self.log(sender, "broadcast", f"to {c}* with delay {delay:2d}: {message}")
|
||||
|
||||
# Run `convey` in a new process for each node.
|
||||
for target in range(self.num_nodes()):
|
||||
if target != sender:
|
||||
if include_self or target != sender:
|
||||
Process(self.env, self.convey(delay, sender, target, message))
|
||||
|
||||
# Broadcasting is currently instantaneous.
|
||||
|
|
|
@ -89,7 +89,7 @@ class SequentialNode(Node):
|
|||
while True:
|
||||
while len(self._mailbox) > 0:
|
||||
(sender, message) = self._mailbox.popleft()
|
||||
self.log("handle", f"from {sender:2d}: {message}")
|
||||
self.log("handle", f"from {sender:2d}: {message}")
|
||||
yield from self.handle(sender, message)
|
||||
|
||||
# This naive implementation is fine because we have no actual
|
||||
|
@ -147,7 +147,7 @@ class SenderTestNode(PassiveNode):
|
|||
yield Timeout(self.env, 1)
|
||||
|
||||
# This message is broadcast at time 4 and received at time 5.
|
||||
yield from self.broadcast(PayloadMessage(4))
|
||||
yield from self.broadcast(PayloadMessage(4), False)
|
||||
|
||||
|
||||
class TestFramework(unittest.TestCase):
|
||||
|
|
Loading…
Reference in New Issue